C25H26N2O3 — CID 17000212
2-(furan-2-yl)-1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazole (PubChem CID 17000212) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazole.
| Compound Name | 2-(furan-2-yl)-1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazole |
|---|---|
| PubChem CID | 17000212 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-(furan-2-yl)-1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazole |
| SMILES | C=CCc1ccc(OCCCCn2c(-c3ccco3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-3-9-19-13-14-22(24(18-19)28-2)29-16-7-6-15-27-21-11-5-4-10-20(21)26-25(27)23-12-8-17-30-23/h3-5,8,10-14,17-18H,1,6-7,9,15-16H2,2H3 |
| InChIKey | ZXOFFGOQQHJDPJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 49.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|