C25H28N2O2 — CID 18879439
2-(furan-2-yl)-1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazole (PubChem CID 18879439) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazole.
| Compound Name | 2-(furan-2-yl)-1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazole |
|---|---|
| PubChem CID | 18879439 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-(furan-2-yl)-1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazole |
| SMILES | Cc1ccc(C(C)C)c(OCCCCn2c(-c3ccco3)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H28N2O2/c1-18(2)20-13-12-19(3)17-24(20)29-15-7-6-14-27-22-10-5-4-9-21(22)26-25(27)23-11-8-16-28-23/h4-5,8-13,16-18H,6-7,14-15H2,1-3H3 |
| InChIKey | AKHWGKYBNNTJRC-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 40.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|