C28H32N2O2 — CID 16995164
[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]-phenylmethanol (PubChem CID 16995164) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is [1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]-phenylmethanol.
| Compound Name | [1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 16995164 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | [1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]-phenylmethanol |
| SMILES | Cc1ccc(C(C)C)c(OCCCCn2c(C(O)c3ccccc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C28H32N2O2/c1-20(2)23-16-15-21(3)19-26(23)32-18-10-9-17-30-25-14-8-7-13-24(25)29-28(30)27(31)22-11-5-4-6-12-22/h4-8,11-16,19-20,27,31H,9-10,17-18H2,1-3H3 |
| InChIKey | UKLSNFNOEIRQNT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|