C28H32N2O — CID 18879213
2-(2-methylphenyl)-1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazole (PubChem CID 18879213) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazole.
| Compound Name | 2-(2-methylphenyl)-1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazole |
|---|---|
| PubChem CID | 18879213 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-(2-methylphenyl)-1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazole |
| SMILES | Cc1ccc(C(C)C)c(OCCCCn2c(-c3ccccc3C)nc3ccccc32)c1 |
| InChI | InChI=1S/C28H32N2O/c1-20(2)23-16-15-21(3)19-27(23)31-18-10-9-17-30-26-14-8-7-13-25(26)29-28(30)24-12-6-5-11-22(24)4/h5-8,11-16,19-20H,9-10,17-18H2,1-4H3 |
| InChIKey | QGCWLLNILSTGSV-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|