C26H28N2O2 — CID 16995174
[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-phenylmethanol (PubChem CID 16995174) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is [1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-phenylmethanol.
| Compound Name | [1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 16995174 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]-phenylmethanol |
| SMILES | Cc1cc(C)cc(OCCCCn2c(C(O)c3ccccc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C26H28N2O2/c1-19-16-20(2)18-22(17-19)30-15-9-8-14-28-24-13-7-6-12-23(24)27-26(28)25(29)21-10-4-3-5-11-21/h3-7,10-13,16-18,25,29H,8-9,14-15H2,1-2H3 |
| InChIKey | YPKWFVAUKASCSH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|