C34H34N2O2 — CID 16987459
1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-2-[(4-phenylphenyl)methyl]benzimidazole (PubChem CID 16987459) has the molecular formula C34H34N2O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-2-[(4-phenylphenyl)methyl]benzimidazole.
| Compound Name | 1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-2-[(4-phenylphenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 16987459 |
| Molecular Formula | C34H34N2O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-2-[(4-phenylphenyl)methyl]benzimidazole |
| SMILES | C/C=C/c1ccc(OCCCCn2c(Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C34H34N2O2/c1-3-11-26-18-21-32(33(24-26)37-2)38-23-10-9-22-36-31-15-8-7-14-30(31)35-34(36)25-27-16-19-29(20-17-27)28-12-5-4-6-13-28/h3-8,11-21,24H,9-10,22-23,25H2,1-2H3/b11-3+ |
| InChIKey | MXOWPYBEKKTZBE-QDEBKDIKSA-N |
| XLogP | 8.19 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|