C25H31N3O4 — CID 17006614
2-methoxy-N-[[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]methyl]acetamide (PubChem CID 17006614) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-methoxy-N-[[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]methyl]acetamide.
| Compound Name | 2-methoxy-N-[[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 17006614 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-methoxy-N-[[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]methyl]acetamide |
| SMILES | C/C=C/c1ccc(OCCCCn2c(CNC(=O)COC)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C25H31N3O4/c1-4-9-19-12-13-22(23(16-19)31-3)32-15-8-7-14-28-21-11-6-5-10-20(21)27-24(28)17-26-25(29)18-30-2/h4-6,9-13,16H,7-8,14-15,17-18H2,1-3H3,(H,26,29)/b9-4+ |
| InChIKey | DVBHHKRZVXHOEM-RUDMXATFSA-N |
| XLogP | 4.20 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|