C32H32N2O3 — CID 16999294
1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-2-(naphthalen-2-yloxymethyl)benzimidazole (PubChem CID 16999294) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-2-(naphthalen-2-yloxymethyl)benzimidazole.
| Compound Name | 1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-2-(naphthalen-2-yloxymethyl)benzimidazole |
|---|---|
| PubChem CID | 16999294 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]-2-(naphthalen-2-yloxymethyl)benzimidazole |
| SMILES | C/C=C/c1ccc(OCCCCn2c(COc3ccc4ccccc4c3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C32H32N2O3/c1-3-10-24-15-18-30(31(21-24)35-2)36-20-9-8-19-34-29-14-7-6-13-28(29)33-32(34)23-37-27-17-16-25-11-4-5-12-26(25)22-27/h3-7,10-18,21-22H,8-9,19-20,23H2,1-2H3/b10-3+ |
| InChIKey | ZQAVZMGGIPGXJP-XCVCLJGOSA-N |
| XLogP | 7.67 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|