C28H29ClN2O2 — CID 16995848
2-[(4-chlorophenyl)methyl]-1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazole (PubChem CID 16995848) has the molecular formula C28H29ClN2O2 and a molecular weight of 461.01 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazole.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazole |
|---|---|
| PubChem CID | 16995848 |
| Molecular Formula | C28H29ClN2O2 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazole |
| SMILES | C/C=C/c1ccc(OCCCCn2c(Cc3ccc(Cl)cc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C28H29ClN2O2/c1-3-8-21-13-16-26(27(19-21)32-2)33-18-7-6-17-31-25-10-5-4-9-24(25)30-28(31)20-22-11-14-23(29)15-12-22/h3-5,8-16,19H,6-7,17-18,20H2,1-2H3/b8-3+ |
| InChIKey | XPNSXZOJYICXOD-FPYGCLRLSA-N |
| XLogP | 7.18 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|