C21H20N2O3 — CID 17000191
2-(furan-2-yl)-1-[3-(3-methoxyphenoxy)propyl]benzimidazole (PubChem CID 17000191) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-[3-(3-methoxyphenoxy)propyl]benzimidazole.
| Compound Name | 2-(furan-2-yl)-1-[3-(3-methoxyphenoxy)propyl]benzimidazole |
|---|---|
| PubChem CID | 17000191 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-(furan-2-yl)-1-[3-(3-methoxyphenoxy)propyl]benzimidazole |
| SMILES | COc1cccc(OCCCn2c(-c3ccco3)nc3ccccc32)c1 |
| InChI | InChI=1S/C21H20N2O3/c1-24-16-7-4-8-17(15-16)25-14-6-12-23-19-10-3-2-9-18(19)22-21(23)20-11-5-13-26-20/h2-5,7-11,13,15H,6,12,14H2,1H3 |
| InChIKey | SGSHCXLKNXENTQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|