C26H31N3O3 — CID 17002328
4-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]-1-methylpyrrolidin-2-one (PubChem CID 17002328) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 4-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]-1-methylpyrrolidin-2-one.
| Compound Name | 4-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 17002328 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 4-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]-1-methylpyrrolidin-2-one |
| SMILES | C/C=C/c1ccc(OCCCCn2c(C3CC(=O)N(C)C3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C26H31N3O3/c1-4-9-19-12-13-23(24(16-19)31-3)32-15-8-7-14-29-22-11-6-5-10-21(22)27-26(29)20-17-25(30)28(2)18-20/h4-6,9-13,16,20H,7-8,14-15,17-18H2,1-3H3/b9-4+ |
| InChIKey | NEYDBOYBZLIQSF-RUDMXATFSA-N |
| XLogP | 4.88 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|