C30H30FN3O3 — CID 17003448
1-(2-fluorophenyl)-4-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 17003448) has the molecular formula C30H30FN3O3 and a molecular weight of 499.59 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-(2-fluorophenyl)-4-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17003448 |
| Molecular Formula | C30H30FN3O3 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | C/C=C/c1ccc(OCCCn2c(C3CC(=O)N(c4ccccc4F)C3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C30H30FN3O3/c1-3-9-21-14-15-27(28(18-21)36-2)37-17-8-16-33-26-13-7-5-11-24(26)32-30(33)22-19-29(35)34(20-22)25-12-6-4-10-23(25)31/h3-7,9-15,18,22H,8,16-17,19-20H2,1-2H3/b9-3+ |
| InChIKey | WIEFDFWFOBPISD-YCRREMRBSA-N |
| XLogP | 6.21 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|