C23H26BrN3O — CID 16991539
4-bromo-N-[5-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991539) has the molecular formula C23H26BrN3O and a molecular weight of 440.39 g/mol. Its IUPAC name is 4-bromo-N-[5-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 4-bromo-N-[5-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991539 |
| Molecular Formula | C23H26BrN3O |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-bromo-N-[5-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]pentyl]benzamide |
| SMILES | C=C(C)Cn1c(CCCCCNC(=O)c2ccc(Br)cc2)nc2ccccc21 |
| InChI | InChI=1S/C23H26BrN3O/c1-17(2)16-27-21-9-6-5-8-20(21)26-22(27)10-4-3-7-15-25-23(28)18-11-13-19(24)14-12-18/h5-6,8-9,11-14H,1,3-4,7,10,15-16H2,2H3,(H,25,28) |
| InChIKey | URXXTAUWJQHYFH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|