C26H33N3O3 — CID 16992404
N-[5-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-methylprop-2-enamide (PubChem CID 16992404) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[5-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-methylprop-2-enamide.
| Compound Name | N-[5-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 16992404 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | N-[5-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCc1nc2ccccc2n1CCOc1ccccc1OCC |
| InChI | InChI=1S/C26H33N3O3/c1-4-31-23-14-9-10-15-24(23)32-19-18-29-22-13-8-7-12-21(22)28-25(29)16-6-5-11-17-27-26(30)20(2)3/h7-10,12-15H,2,4-6,11,16-19H2,1,3H3,(H,27,30) |
| InChIKey | RYBPBFKBOHMXBZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|