C33H41N3O2 — CID 16993443
2-phenyl-N-[5-[1-[4-(4-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993443) has the molecular formula C33H41N3O2 and a molecular weight of 511.71 g/mol. Its IUPAC name is 2-phenyl-N-[5-[1-[4-(4-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-phenyl-N-[5-[1-[4-(4-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993443 |
| Molecular Formula | C33H41N3O2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | 2-phenyl-N-[5-[1-[4-(4-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | CC(C)c1ccc(OCCCCn2c(CCCCCNC(=O)Cc3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C33H41N3O2/c1-26(2)28-18-20-29(21-19-28)38-24-12-11-23-36-31-16-9-8-15-30(31)35-32(36)17-7-4-10-22-34-33(37)25-27-13-5-3-6-14-27/h3,5-6,8-9,13-16,18-21,26H,4,7,10-12,17,22-25H2,1-2H3,(H,34,37) |
| InChIKey | YDJWNDKBAAYNKN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|