C29H35N3O3 — CID 16994710
N-[5-[1-[3-(4-propan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]furan-2-carboxamide (PubChem CID 16994710) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[5-[1-[3-(4-propan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]furan-2-carboxamide.
| Compound Name | N-[5-[1-[3-(4-propan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 16994710 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | N-[5-[1-[3-(4-propan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]furan-2-carboxamide |
| SMILES | CC(C)c1ccc(OCCCn2c(CCCCCNC(=O)c3ccco3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C29H35N3O3/c1-22(2)23-14-16-24(17-15-23)34-21-9-19-32-26-11-6-5-10-25(26)31-28(32)13-4-3-7-18-30-29(33)27-12-8-20-35-27/h5-6,8,10-12,14-17,20,22H,3-4,7,9,13,18-19,21H2,1-2H3,(H,30,33) |
| InChIKey | IIGBADRHNJRQRH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|