C29H35N3O3 — CID 16994722
N-[5-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]furan-2-carboxamide (PubChem CID 16994722) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[5-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]furan-2-carboxamide.
| Compound Name | N-[5-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 16994722 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | N-[5-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]furan-2-carboxamide |
| SMILES | Cc1cccc(C)c1OCCCCn1c(CCCCCNC(=O)c2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C29H35N3O3/c1-22-12-10-13-23(2)28(22)35-20-9-8-19-32-25-15-6-5-14-24(25)31-27(32)17-4-3-7-18-30-29(33)26-16-11-21-34-26/h5-6,10-16,21H,3-4,7-9,17-20H2,1-2H3,(H,30,33) |
| InChIKey | UVROLRBKQXTTCZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|