C24H23N3O3 — CID 16997554
2-[2-[(2-methoxyphenoxy)methyl]benzimidazol-1-yl]-N-methyl-N-phenylacetamide (PubChem CID 16997554) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-[2-[(2-methoxyphenoxy)methyl]benzimidazol-1-yl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[2-[(2-methoxyphenoxy)methyl]benzimidazol-1-yl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 16997554 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-[2-[(2-methoxyphenoxy)methyl]benzimidazol-1-yl]-N-methyl-N-phenylacetamide |
| SMILES | COc1ccccc1OCc1nc2ccccc2n1CC(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O3/c1-26(18-10-4-3-5-11-18)24(28)16-27-20-13-7-6-12-19(20)25-23(27)17-30-22-15-9-8-14-21(22)29-2/h3-15H,16-17H2,1-2H3 |
| InChIKey | NPSMJIWRMHTXFP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |