C25H26N2O2 — CID 16998835
1-[2-(3,5-dimethylphenoxy)ethyl]-2-(1-phenoxyethyl)benzimidazole (PubChem CID 16998835) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)ethyl]-2-(1-phenoxyethyl)benzimidazole.
| Compound Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-2-(1-phenoxyethyl)benzimidazole |
|---|---|
| PubChem CID | 16998835 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-2-(1-phenoxyethyl)benzimidazole |
| SMILES | Cc1cc(C)cc(OCCn2c(C(C)Oc3ccccc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H26N2O2/c1-18-15-19(2)17-22(16-18)28-14-13-27-24-12-8-7-11-23(24)26-25(27)20(3)29-21-9-5-4-6-10-21/h4-12,15-17,20H,13-14H2,1-3H3 |
| InChIKey | HDXVEZQKYPEUFU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |