C22H22N2OS — CID 17000296
1-[3-(2,4-dimethylphenoxy)propyl]-2-thiophen-2-ylbenzimidazole (PubChem CID 17000296) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylphenoxy)propyl]-2-thiophen-2-ylbenzimidazole.
| Compound Name | 1-[3-(2,4-dimethylphenoxy)propyl]-2-thiophen-2-ylbenzimidazole |
|---|---|
| PubChem CID | 17000296 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-[3-(2,4-dimethylphenoxy)propyl]-2-thiophen-2-ylbenzimidazole |
| SMILES | Cc1ccc(OCCCn2c(-c3cccs3)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C22H22N2OS/c1-16-10-11-20(17(2)15-16)25-13-6-12-24-19-8-4-3-7-18(19)23-22(24)21-9-5-14-26-21/h3-5,7-11,14-15H,6,12-13H2,1-2H3 |
| InChIKey | LAVSHQLGANXLAZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|