C22H28N2O — CID 17000411
2-tert-butyl-1-[3-(2,4-dimethylphenoxy)propyl]benzimidazole (PubChem CID 17000411) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-tert-butyl-1-[3-(2,4-dimethylphenoxy)propyl]benzimidazole.
| Compound Name | 2-tert-butyl-1-[3-(2,4-dimethylphenoxy)propyl]benzimidazole |
|---|---|
| PubChem CID | 17000411 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 2-tert-butyl-1-[3-(2,4-dimethylphenoxy)propyl]benzimidazole |
| SMILES | Cc1ccc(OCCCn2c(C(C)(C)C)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C22H28N2O/c1-16-11-12-20(17(2)15-16)25-14-8-13-24-19-10-7-6-9-18(19)23-21(24)22(3,4)5/h6-7,9-12,15H,8,13-14H2,1-5H3 |
| InChIKey | IDPBGRDJLNWEON-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|