C20H19ClFN3O4S — CID 170002997
N-[3-[[2-(7-azabicyclo[4.1.0]hepta-1,3,5-trien-7-yloxysulfanyl)acetyl]amino]but-3-enyl]-2-(4-chloro-3-fluorophenoxy)acetamide (PubChem CID 170002997) has the molecular formula C20H19ClFN3O4S and a molecular weight of 451.91 g/mol. Its IUPAC name is N-[3-[[2-(7-azabicyclo[4.1.0]hepta-1,3,5-trien-7-yloxysulfanyl)acetyl]amino]but-3-enyl]-2-(4-chloro-3-fluorophenoxy)acetamide.
| Compound Name | N-[3-[[2-(7-azabicyclo[4.1.0]hepta-1,3,5-trien-7-yloxysulfanyl)acetyl]amino]but-3-enyl]-2-(4-chloro-3-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 170002997 |
| Molecular Formula | C20H19ClFN3O4S |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-[3-[[2-(7-azabicyclo[4.1.0]hepta-1,3,5-trien-7-yloxysulfanyl)acetyl]amino]but-3-enyl]-2-(4-chloro-3-fluorophenoxy)acetamide |
| SMILES | C=C(CCNC(=O)COc1ccc(Cl)c(F)c1)NC(=O)CSON1c2ccccc21 |
| InChI | InChI=1S/C20H19ClFN3O4S/c1-13(24-20(27)12-30-29-25-17-4-2-3-5-18(17)25)8-9-23-19(26)11-28-14-6-7-15(21)16(22)10-14/h2-7,10H,1,8-9,11-12H2,(H,23,26)(H,24,27) |
| InChIKey | DRMKRBKNCAVPTG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|