C21H25F2N5O — CID 170004964
1-[3-[6-(4,4-difluoropiperidin-1-yl)-4-(1-methylpyrazol-3-yl)-3-pyridinyl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170004964) has the molecular formula C21H25F2N5O and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-[3-[6-(4,4-difluoropiperidin-1-yl)-4-(1-methylpyrazol-3-yl)-3-pyridinyl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[6-(4,4-difluoropiperidin-1-yl)-4-(1-methylpyrazol-3-yl)-3-pyridinyl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170004964 |
| Molecular Formula | C21H25F2N5O |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[3-[6-(4,4-difluoropiperidin-1-yl)-4-(1-methylpyrazol-3-yl)-3-pyridinyl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2cnc(N3CCC(F)(F)CC3)cc2-c2ccn(C)n2)C1 |
| InChI | InChI=1S/C21H25F2N5O/c1-3-20(29)28-9-4-15(14-28)17-13-24-19(27-10-6-21(22,23)7-11-27)12-16(17)18-5-8-26(2)25-18/h3,5,8,12-13,15H,1,4,6-7,9-11,14H2,2H3 |
| InChIKey | FWRRRFHXXVGGGF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|