C35H34F3N5O — CID 170006051
4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6,8-difluoro-2-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethynyl]quinazolin-7-yl]-5-ethylnaphthalen-2-ol (PubChem CID 170006051) has the molecular formula C35H34F3N5O and a molecular weight of 597.69 g/mol. Its IUPAC name is 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6,8-difluoro-2-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethynyl]quinazolin-7-yl]-5-ethylnaphthalen-2-ol.
| Compound Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6,8-difluoro-2-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethynyl]quinazolin-7-yl]-5-ethylnaphthalen-2-ol |
|---|---|
| PubChem CID | 170006051 |
| Molecular Formula | C35H34F3N5O |
| Molecular Weight | 597.69 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6,8-difluoro-2-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethynyl]quinazolin-7-yl]-5-ethylnaphthalen-2-ol |
| SMILES | CCc1cccc2cc(O)cc(-c3c(F)cc4c(N5CC6CCC(C5)N6)nc(C#CC56CCCN5CC(F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C35H34F3N5O/c1-2-20-5-3-6-21-13-25(44)14-26(30(20)21)31-28(37)15-27-33(32(31)38)40-29(9-11-35-10-4-12-43(35)17-22(36)16-35)41-34(27)42-18-23-7-8-24(19-42)39-23/h3,5-6,13-15,22-24,39,44H,2,4,7-8,10,12,16-19H2,1H3 |
| InChIKey | UJGNRKPINZGBGU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|