C33H31ClF3N3O6S — CID 170007697
4-[3-[4-[[[1-[(2-chloro-6-fluorophenyl)methyl]-3,3-dimethyl-2-oxoindole-6-carbonyl]amino]methyl]-3,5-difluorophenyl]prop-2-ynoylamino]butyl methanesulfonate (PubChem CID 170007697) has the molecular formula C33H31ClF3N3O6S and a molecular weight of 690.14 g/mol. Its IUPAC name is 4-[3-[4-[[[1-[(2-chloro-6-fluorophenyl)methyl]-3,3-dimethyl-2-oxoindole-6-carbonyl]amino]methyl]-3,5-difluorophenyl]prop-2-ynoylamino]butyl methanesulfonate.
| Compound Name | 4-[3-[4-[[[1-[(2-chloro-6-fluorophenyl)methyl]-3,3-dimethyl-2-oxoindole-6-carbonyl]amino]methyl]-3,5-difluorophenyl]prop-2-ynoylamino]butyl methanesulfonate |
|---|---|
| PubChem CID | 170007697 |
| Molecular Formula | C33H31ClF3N3O6S |
| Molecular Weight | 690.14 g/mol |
| Exact Mass | 689.16 |
| IUPAC Name | 4-[3-[4-[[[1-[(2-chloro-6-fluorophenyl)methyl]-3,3-dimethyl-2-oxoindole-6-carbonyl]amino]methyl]-3,5-difluorophenyl]prop-2-ynoylamino]butyl methanesulfonate |
| SMILES | CC1(C)C(=O)N(Cc2c(F)cccc2Cl)c2cc(C(=O)NCc3c(F)cc(C#CC(=O)NCCCCOS(C)(=O)=O)cc3F)ccc21 |
| InChI | InChI=1S/C33H31ClF3N3O6S/c1-33(2)24-11-10-21(17-29(24)40(32(33)43)19-23-25(34)7-6-8-26(23)35)31(42)39-18-22-27(36)15-20(16-28(22)37)9-12-30(41)38-13-4-5-14-46-47(3,44)45/h6-8,10-11,15-17H,4-5,13-14,18-19H2,1-3H3,(H,38,41)(H,39,42) |
| InChIKey | DMZMKZKTSKXLJN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.14 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|