C25H20F3N5O2 — CID 146592702
1-[(4-azidophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide (PubChem CID 146592702) has the molecular formula C25H20F3N5O2 and a molecular weight of 479.46 g/mol. Its IUPAC name is 1-[(4-azidophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide.
| Compound Name | 1-[(4-azidophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 146592702 |
| Molecular Formula | C25H20F3N5O2 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 1-[(4-azidophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide |
| SMILES | CC1(C)C(=O)N(Cc2ccc(N=[N+]=[N-])cc2)c2cc(C(=O)NCc3c(F)cc(F)cc3F)ccc21 |
| InChI | InChI=1S/C25H20F3N5O2/c1-25(2)19-8-5-15(23(34)30-12-18-20(27)10-16(26)11-21(18)28)9-22(19)33(24(25)35)13-14-3-6-17(7-4-14)31-32-29/h3-11H,12-13H2,1-2H3,(H,30,34) |
| InChIKey | KXEUXIOFTKSQSJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|