C24H18F5N3O2 — CID 146592755
1-[(3,5-difluorophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]pyrrolo[3,2-c]pyridine-6-carboxamide (PubChem CID 146592755) has the molecular formula C24H18F5N3O2 and a molecular weight of 475.42 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]pyrrolo[3,2-c]pyridine-6-carboxamide.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]pyrrolo[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 146592755 |
| Molecular Formula | C24H18F5N3O2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]pyrrolo[3,2-c]pyridine-6-carboxamide |
| SMILES | CC1(C)C(=O)N(Cc2cc(F)cc(F)c2)c2cc(C(=O)NCc3c(F)cc(F)cc3F)ncc21 |
| InChI | InChI=1S/C24H18F5N3O2/c1-24(2)17-10-30-20(22(33)31-9-16-18(28)6-15(27)7-19(16)29)8-21(17)32(23(24)34)11-12-3-13(25)5-14(26)4-12/h3-8,10H,9,11H2,1-2H3,(H,31,33) |
| InChIKey | DMEIRJLOOVCRLB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |