C14H10F3N3O2 — CID 169100410
5-N-[(2,4,6-trifluorophenyl)methyl]pyridine-2,5-dicarboxamide (PubChem CID 169100410) has the molecular formula C14H10F3N3O2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 5-N-[(2,4,6-trifluorophenyl)methyl]pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[(2,4,6-trifluorophenyl)methyl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 169100410 |
| Molecular Formula | C14H10F3N3O2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-N-[(2,4,6-trifluorophenyl)methyl]pyridine-2,5-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NCc2c(F)cc(F)cc2F)cn1 |
| InChI | InChI=1S/C14H10F3N3O2/c15-8-3-10(16)9(11(17)4-8)6-20-14(22)7-1-2-12(13(18)21)19-5-7/h1-5H,6H2,(H2,18,21)(H,20,22) |
| InChIKey | DXFOVRCRERDGCP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |