C25H18F5N3O3 — CID 142502484
1-[(3,5-difluorophenyl)methyl]-3-methyl-2-oxo-6-N-[(2,4,6-trifluorophenyl)methyl]indole-3,6-dicarboxamide (PubChem CID 142502484) has the molecular formula C25H18F5N3O3 and a molecular weight of 503.43 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-3-methyl-2-oxo-6-N-[(2,4,6-trifluorophenyl)methyl]indole-3,6-dicarboxamide.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-3-methyl-2-oxo-6-N-[(2,4,6-trifluorophenyl)methyl]indole-3,6-dicarboxamide |
|---|---|
| PubChem CID | 142502484 |
| Molecular Formula | C25H18F5N3O3 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-3-methyl-2-oxo-6-N-[(2,4,6-trifluorophenyl)methyl]indole-3,6-dicarboxamide |
| SMILES | CC1(C(N)=O)C(=O)N(Cc2cc(F)cc(F)c2)c2cc(C(=O)NCc3c(F)cc(F)cc3F)ccc21 |
| InChI | InChI=1S/C25H18F5N3O3/c1-25(23(31)35)18-3-2-13(22(34)32-10-17-19(29)8-16(28)9-20(17)30)6-21(18)33(24(25)36)11-12-4-14(26)7-15(27)5-12/h2-9H,10-11H2,1H3,(H2,31,35)(H,32,34) |
| InChIKey | DDJGPGNWGDMAOR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|