C26H22F3IN2O2 — CID 137367658
4-iodo-3,3-dimethyl-1-[(3-methylphenyl)methyl]-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide (PubChem CID 137367658) has the molecular formula C26H22F3IN2O2 and a molecular weight of 578.37 g/mol. Its IUPAC name is 4-iodo-3,3-dimethyl-1-[(3-methylphenyl)methyl]-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide.
| Compound Name | 4-iodo-3,3-dimethyl-1-[(3-methylphenyl)methyl]-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 137367658 |
| Molecular Formula | C26H22F3IN2O2 |
| Molecular Weight | 578.37 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | 4-iodo-3,3-dimethyl-1-[(3-methylphenyl)methyl]-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide |
| SMILES | Cc1cccc(CN2C(=O)C(C)(C)c3c(I)cc(C(=O)NCc4c(F)cc(F)cc4F)cc32)c1 |
| InChI | InChI=1S/C26H22F3IN2O2/c1-14-5-4-6-15(7-14)13-32-22-9-16(8-21(30)23(22)26(2,3)25(32)34)24(33)31-12-18-19(28)10-17(27)11-20(18)29/h4-11H,12-13H2,1-3H3,(H,31,33) |
| InChIKey | TWGXSPJBVSYASN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.37 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|