C17H19N6O4P — CID 170008519
2-[5-cyano-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]ethylphosphonic acid (PubChem CID 170008519) has the molecular formula C17H19N6O4P and a molecular weight of 402.35 g/mol. Its IUPAC name is 2-[5-cyano-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]ethylphosphonic acid.
| Compound Name | 2-[5-cyano-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 170008519 |
| Molecular Formula | C17H19N6O4P |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[5-cyano-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]ethylphosphonic acid |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C#N)ccc2n1CCP(=O)(O)O |
| InChI | InChI=1S/C17H19N6O4P/c1-3-23-15(8-11(2)21-23)16(24)20-17-19-13-9-12(10-18)4-5-14(13)22(17)6-7-28(25,26)27/h4-5,8-9H,3,6-7H2,1-2H3,(H,19,20,24)(H2,25,26,27) |
| InChIKey | VVFRUSKIUNZTLN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 146.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|