C23H20N4O2S2 — CID 170009333
5-(2-formamido-1,3-benzothiazol-6-yl)-N-[(2E,4Z)-5-methylsulfanylpenta-2,4-dienyl]-1H-indole-3-carboxamide (PubChem CID 170009333) has the molecular formula C23H20N4O2S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 5-(2-formamido-1,3-benzothiazol-6-yl)-N-[(2E,4Z)-5-methylsulfanylpenta-2,4-dienyl]-1H-indole-3-carboxamide.
| Compound Name | 5-(2-formamido-1,3-benzothiazol-6-yl)-N-[(2E,4Z)-5-methylsulfanylpenta-2,4-dienyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 170009333 |
| Molecular Formula | C23H20N4O2S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 5-(2-formamido-1,3-benzothiazol-6-yl)-N-[(2E,4Z)-5-methylsulfanylpenta-2,4-dienyl]-1H-indole-3-carboxamide |
| SMILES | CS/C=C\C=C\CNC(=O)c1c[nH]c2ccc(-c3ccc4nc(NC=O)sc4c3)cc12 |
| InChI | InChI=1S/C23H20N4O2S2/c1-30-10-4-2-3-9-24-22(29)18-13-25-19-7-5-15(11-17(18)19)16-6-8-20-21(12-16)31-23(27-20)26-14-28/h2-8,10-14,25H,9H2,1H3,(H,24,29)(H,26,27,28)/b3-2+,10-4- |
| InChIKey | YKTGAGUOKJLGNV-VAIMCSMNSA-N |
| XLogP | 5.18 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|