C25H27Cl2F2N2O7P — CID 170009395
[(2S)-1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl]oxymethoxyphosphinous acid (PubChem CID 170009395) has the molecular formula C25H27Cl2F2N2O7P and a molecular weight of 607.37 g/mol. Its IUPAC name is [(2S)-1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl]oxymethoxyphosphinous acid.
| Compound Name | [(2S)-1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl]oxymethoxyphosphinous acid |
|---|---|
| PubChem CID | 170009395 |
| Molecular Formula | C25H27Cl2F2N2O7P |
| Molecular Weight | 607.37 g/mol |
| Exact Mass | 606.09 |
| IUPAC Name | [(2S)-1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl]oxymethoxyphosphinous acid |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NC12CCC(NC(=O)COc3ccc(Cl)c(F)c3)(CC1)[C@@H](OCOPO)C2 |
| InChI | InChI=1S/C25H27Cl2F2N2O7P/c26-17-3-1-15(9-19(17)28)35-12-22(32)30-24-5-7-25(8-6-24,21(11-24)37-14-38-39-34)31-23(33)13-36-16-2-4-18(27)20(29)10-16/h1-4,9-10,21,34,39H,5-8,11-14H2,(H,30,32)(H,31,33)/t21-,24?,25?/m0/s1 |
| InChIKey | GRLIBMGGYFTIME-ANYOXOOPSA-N |
| XLogP | 4.28 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|