C17H22ClFN2O4S — CID 176696305
2-(4-chloro-3-fluorophenoxy)-N-[3-hydroxysulfanyloxy-4-(methylamino)-1-bicyclo[2.2.2]octanyl]acetamide (PubChem CID 176696305) has the molecular formula C17H22ClFN2O4S and a molecular weight of 404.89 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenoxy)-N-[3-hydroxysulfanyloxy-4-(methylamino)-1-bicyclo[2.2.2]octanyl]acetamide.
| Compound Name | 2-(4-chloro-3-fluorophenoxy)-N-[3-hydroxysulfanyloxy-4-(methylamino)-1-bicyclo[2.2.2]octanyl]acetamide |
|---|---|
| PubChem CID | 176696305 |
| Molecular Formula | C17H22ClFN2O4S |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-(4-chloro-3-fluorophenoxy)-N-[3-hydroxysulfanyloxy-4-(methylamino)-1-bicyclo[2.2.2]octanyl]acetamide |
| SMILES | CNC12CCC(NC(=O)COc3ccc(Cl)c(F)c3)(CC1)CC2OSO |
| InChI | InChI=1S/C17H22ClFN2O4S/c1-20-17-6-4-16(5-7-17,9-14(17)25-26-23)21-15(22)10-24-11-2-3-12(18)13(19)8-11/h2-3,8,14,20,23H,4-7,9-10H2,1H3,(H,21,22) |
| InChIKey | GHEJZWXHSHRNIA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|