C23H21BrN2 — CID 17001144
2-(4-bromophenyl)-1-[(2,4,6-trimethylphenyl)methyl]benzimidazole (PubChem CID 17001144) has the molecular formula C23H21BrN2 and a molecular weight of 405.34 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-[(2,4,6-trimethylphenyl)methyl]benzimidazole.
| Compound Name | 2-(4-bromophenyl)-1-[(2,4,6-trimethylphenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 17001144 |
| Molecular Formula | C23H21BrN2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-(4-bromophenyl)-1-[(2,4,6-trimethylphenyl)methyl]benzimidazole |
| SMILES | Cc1cc(C)c(Cn2c(-c3ccc(Br)cc3)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C23H21BrN2/c1-15-12-16(2)20(17(3)13-15)14-26-22-7-5-4-6-21(22)25-23(26)18-8-10-19(24)11-9-18/h4-13H,14H2,1-3H3 |
| InChIKey | PJDAQQKVEYXMJP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |