About CID 10763839
CID 10763839 (PubChem CID 10763839) has the molecular formula C20H17N2
and a molecular weight of 285.37 g/mol.
Molecular Properties
| Compound Name | CID 10763839 |
| PubChem CID | 10763839 |
| Molecular Formula | C20H17N2 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2nc3ccccc3n2C[C]2[CH][CH][CH][CH]2)cc1 |
| InChI | InChI=1S/C20H17N2/c1-15-10-12-17(13-11-15)20-21-18-8-4-5-9-19(18)22(20)14-16-6-2-3-7-16/h2-13H,14H2,1H3 |
| InChIKey | ITKKAWOHZKIJEZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 10763839 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10763839?
The IUPAC name of CID 10763839 (CID 10763839) is not available.
What is the SMILES notation for CID 10763839?
The canonical SMILES for CID 10763839 is Cc1ccc(-c2nc3ccccc3n2C[C]2[CH][CH][CH][CH]2)cc1.
What is the InChIKey of CID 10763839?
The InChIKey is ITKKAWOHZKIJEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N2/c1-15-10-12-17(13-11-15)20-21-18-8-4-5-9-19(18)22(20)14-16-6-2-3-7-16/h2-13H,14H2,1H3.
What are the key properties of CID 10763839?
CID 10763839 has a molecular weight of 285.37 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10763839 is sourced from PubChem (CID 10763839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).