C16H19N5O3S — CID 170012627
2-[(2E)-2-(formylhydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 170012627) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is 2-[(2E)-2-(formylhydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(2E)-2-(formylhydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 170012627 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[(2E)-2-(formylhydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=CN/N=C1\NC(=O)C(CC(=O)Nc2ccc(N3CCCC3)cc2)S1 |
| InChI | InChI=1S/C16H19N5O3S/c22-10-17-20-16-19-15(24)13(25-16)9-14(23)18-11-3-5-12(6-4-11)21-7-1-2-8-21/h3-6,10,13H,1-2,7-9H2,(H,17,22)(H,18,23)(H,19,20,24) |
| InChIKey | PVEBOZDHRRCYHG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|