C21H28O16 — CID 170013158
1-methyldodecane-1,2,3,4,6,8,10,12-octacarboxylic acid (PubChem CID 170013158) has the molecular formula C21H28O16 and a molecular weight of 536.44 g/mol. Its IUPAC name is 1-methyldodecane-1,2,3,4,6,8,10,12-octacarboxylic acid.
| Compound Name | 1-methyldodecane-1,2,3,4,6,8,10,12-octacarboxylic acid |
|---|---|
| PubChem CID | 170013158 |
| Molecular Formula | C21H28O16 |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 1-methyldodecane-1,2,3,4,6,8,10,12-octacarboxylic acid |
| SMILES | CC(C(=O)O)C(C(=O)O)C(C(=O)O)C(CC(CC(CC(CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H28O16/c1-7(15(24)25)13(20(34)35)14(21(36)37)11(19(32)33)6-10(18(30)31)5-9(17(28)29)4-8(16(26)27)2-3-12(22)23/h7-11,13-14H,2-6H2,1H3,(H,22,23)(H,24,25)(H,26,27)(H,28,29)(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | MEUMNQUXJSUANH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |