C18H30OS — CID 170013554
triethyl-[3-(4-prop-2-enoxyphenyl)propyl]-λ4-sulfane (PubChem CID 170013554) has the molecular formula C18H30OS and a molecular weight of 294.50 g/mol. Its IUPAC name is triethyl-[3-(4-prop-2-enoxyphenyl)propyl]-λ4-sulfane.
| Compound Name | triethyl-[3-(4-prop-2-enoxyphenyl)propyl]-λ4-sulfane |
|---|---|
| PubChem CID | 170013554 |
| Molecular Formula | C18H30OS |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | triethyl-[3-(4-prop-2-enoxyphenyl)propyl]-λ4-sulfane |
| SMILES | C=CCOc1ccc(CCCS(CC)(CC)CC)cc1 |
| InChI | InChI=1S/C18H30OS/c1-5-15-19-18-13-11-17(12-14-18)10-9-16-20(6-2,7-3)8-4/h5,11-14H,1,6-10,15-16H2,2-4H3 |
| InChIKey | JAYUEHVGUFVNNW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|