C9H17FN2O — CID 170016097
6-fluoro-5,6-dimethyl-2-propan-2-yl-1,3-diazinan-4-one (PubChem CID 170016097) has the molecular formula C9H17FN2O and a molecular weight of 188.25 g/mol. Its IUPAC name is 6-fluoro-5,6-dimethyl-2-propan-2-yl-1,3-diazinan-4-one.
| Compound Name | 6-fluoro-5,6-dimethyl-2-propan-2-yl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 170016097 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 6-fluoro-5,6-dimethyl-2-propan-2-yl-1,3-diazinan-4-one |
| SMILES | CC(C)C1NC(=O)C(C)C(C)(F)N1 |
| InChI | InChI=1S/C9H17FN2O/c1-5(2)7-11-8(13)6(3)9(4,10)12-7/h5-7,12H,1-4H3,(H,11,13) |
| InChIKey | YSLWGRXRJIFHMJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|