C12H21N3O2 — CID 170016264
tert-butyl (2S)-4-amino-5-methanimidoyl-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 170016264) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is tert-butyl (2S)-4-amino-5-methanimidoyl-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-amino-5-methanimidoyl-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 170016264 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | tert-butyl (2S)-4-amino-5-methanimidoyl-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | [H]/N=C/C1=C(N)C[C@H](C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H21N3O2/c1-8-5-10(14)9(6-13)7-15(8)11(16)17-12(2,3)4/h6,8,13H,5,7,14H2,1-4H3/b13-6+/t8-/m0/s1 |
| InChIKey | QPWBPKKYBDPLFZ-UVDXRHSJSA-N |
| XLogP | 1.88 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|