C23H25Cl2NO5 — CID 170016333
3-[2-[2,6-dichloro-4-(2-methoxyethoxy)benzoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-2-methylpropanoic acid (PubChem CID 170016333) has the molecular formula C23H25Cl2NO5 and a molecular weight of 466.36 g/mol. Its IUPAC name is 3-[2-[2,6-dichloro-4-(2-methoxyethoxy)benzoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-2-methylpropanoic acid.
| Compound Name | 3-[2-[2,6-dichloro-4-(2-methoxyethoxy)benzoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 170016333 |
| Molecular Formula | C23H25Cl2NO5 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 3-[2-[2,6-dichloro-4-(2-methoxyethoxy)benzoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-2-methylpropanoic acid |
| SMILES | COCCOc1cc(Cl)c(C(=O)N2CCc3c(CC(C)C(=O)O)cccc3C2)c(Cl)c1 |
| InChI | InChI=1S/C23H25Cl2NO5/c1-14(23(28)29)10-15-4-3-5-16-13-26(7-6-18(15)16)22(27)21-19(24)11-17(12-20(21)25)31-9-8-30-2/h3-5,11-12,14H,6-10,13H2,1-2H3,(H,28,29) |
| InChIKey | TYSLRIJZJDHASR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|