C18H26N4O3S — CID 170017706
tert-butyl 2-[2-methylidenebut-3-enyl(1,3-thiazol-2-ylcarbamoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 170017706) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is tert-butyl 2-[2-methylidenebut-3-enyl(1,3-thiazol-2-ylcarbamoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-methylidenebut-3-enyl(1,3-thiazol-2-ylcarbamoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170017706 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | tert-butyl 2-[2-methylidenebut-3-enyl(1,3-thiazol-2-ylcarbamoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | C=CC(=C)CN(C(=O)Nc1nccs1)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26N4O3S/c1-6-13(2)12-22(16(23)20-15-19-9-11-26-15)14-8-7-10-21(14)17(24)25-18(3,4)5/h6,9,11,14H,1-2,7-8,10,12H2,3-5H3,(H,19,20,23) |
| InChIKey | XTFYIPGTFOQIPT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|