C14H15BrN2O3S2 — CID 170018029
N-[(2-bromo-4-methylphenyl)methyl]-5-(methylsulfamoyl)thiophene-2-carboxamide (PubChem CID 170018029) has the molecular formula C14H15BrN2O3S2 and a molecular weight of 403.32 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)methyl]-5-(methylsulfamoyl)thiophene-2-carboxamide.
| Compound Name | N-[(2-bromo-4-methylphenyl)methyl]-5-(methylsulfamoyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 170018029 |
| Molecular Formula | C14H15BrN2O3S2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)methyl]-5-(methylsulfamoyl)thiophene-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NCc2ccc(C)cc2Br)s1 |
| InChI | InChI=1S/C14H15BrN2O3S2/c1-9-3-4-10(11(15)7-9)8-17-14(18)12-5-6-13(21-12)22(19,20)16-2/h3-7,16H,8H2,1-2H3,(H,17,18) |
| InChIKey | PZKMHFRKYRHFDE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |