C13H12ClFN2O3S2 — CID 162436639
N-[(4-chloro-3-fluorophenyl)methyl]-5-(methylsulfamoyl)thiophene-2-carboxamide (PubChem CID 162436639) has the molecular formula C13H12ClFN2O3S2 and a molecular weight of 362.84 g/mol. Its IUPAC name is N-[(4-chloro-3-fluorophenyl)methyl]-5-(methylsulfamoyl)thiophene-2-carboxamide.
| Compound Name | N-[(4-chloro-3-fluorophenyl)methyl]-5-(methylsulfamoyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 162436639 |
| Molecular Formula | C13H12ClFN2O3S2 |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | N-[(4-chloro-3-fluorophenyl)methyl]-5-(methylsulfamoyl)thiophene-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NCc2ccc(Cl)c(F)c2)s1 |
| InChI | InChI=1S/C13H12ClFN2O3S2/c1-16-22(19,20)12-5-4-11(21-12)13(18)17-7-8-2-3-9(14)10(15)6-8/h2-6,16H,7H2,1H3,(H,17,18) |
| InChIKey | KXZXDSZWUQIPAJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |