C13H10BrClFNOS — CID 79987282
5-bromo-N-[(3-chloro-4-fluorophenyl)methyl]-4-methylthiophene-2-carboxamide (PubChem CID 79987282) has the molecular formula C13H10BrClFNOS and a molecular weight of 362.65 g/mol. Its IUPAC name is 5-bromo-N-[(3-chloro-4-fluorophenyl)methyl]-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[(3-chloro-4-fluorophenyl)methyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79987282 |
| Molecular Formula | C13H10BrClFNOS |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | 5-bromo-N-[(3-chloro-4-fluorophenyl)methyl]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(F)c(Cl)c2)sc1Br |
| InChI | InChI=1S/C13H10BrClFNOS/c1-7-4-11(19-12(7)14)13(18)17-6-8-2-3-10(16)9(15)5-8/h2-5H,6H2,1H3,(H,17,18) |
| InChIKey | PABHDTHXDSLIJB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |