C11H10BrNO2S — CID 115683147
5-bromo-N-(furan-3-ylmethyl)-4-methylthiophene-2-carboxamide (PubChem CID 115683147) has the molecular formula C11H10BrNO2S and a molecular weight of 300.18 g/mol. Its IUPAC name is 5-bromo-N-(furan-3-ylmethyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(furan-3-ylmethyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 115683147 |
| Molecular Formula | C11H10BrNO2S |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | 5-bromo-N-(furan-3-ylmethyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccoc2)sc1Br |
| InChI | InChI=1S/C11H10BrNO2S/c1-7-4-9(16-10(7)12)11(14)13-5-8-2-3-15-6-8/h2-4,6H,5H2,1H3,(H,13,14) |
| InChIKey | RTHVNWPDGIVFMM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |