C23H24ClN7 — CID 170018391
2-amino-5-[4-chloro-6-(3,5-dimethylpiperazin-1-yl)-1,8-naphthyridin-2-yl]-3-(methyliminomethyl)benzonitrile (PubChem CID 170018391) has the molecular formula C23H24ClN7 and a molecular weight of 433.95 g/mol. Its IUPAC name is 2-amino-5-[4-chloro-6-(3,5-dimethylpiperazin-1-yl)-1,8-naphthyridin-2-yl]-3-(methyliminomethyl)benzonitrile.
| Compound Name | 2-amino-5-[4-chloro-6-(3,5-dimethylpiperazin-1-yl)-1,8-naphthyridin-2-yl]-3-(methyliminomethyl)benzonitrile |
|---|---|
| PubChem CID | 170018391 |
| Molecular Formula | C23H24ClN7 |
| Molecular Weight | 433.95 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-amino-5-[4-chloro-6-(3,5-dimethylpiperazin-1-yl)-1,8-naphthyridin-2-yl]-3-(methyliminomethyl)benzonitrile |
| SMILES | C/N=C/c1cc(-c2cc(Cl)c3cc(N4CC(C)NC(C)C4)cnc3n2)cc(C#N)c1N |
| InChI | InChI=1S/C23H24ClN7/c1-13-11-31(12-14(2)29-13)18-6-19-20(24)7-21(30-23(19)28-10-18)15-4-16(8-25)22(26)17(5-15)9-27-3/h4-7,9-10,13-14,29H,11-12,26H2,1-3H3/b27-9+ |
| InChIKey | SYYLHIBKRMJVEK-OXUBWTJQSA-N |
| XLogP | 3.64 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.95 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|