C17H34N2 — CID 170019635
1-tert-butyl-3-[2-(3-tert-butylazetidin-1-yl)propan-2-yl]azetidine (PubChem CID 170019635) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(3-tert-butylazetidin-1-yl)propan-2-yl]azetidine.
| Compound Name | 1-tert-butyl-3-[2-(3-tert-butylazetidin-1-yl)propan-2-yl]azetidine |
|---|---|
| PubChem CID | 170019635 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 1-tert-butyl-3-[2-(3-tert-butylazetidin-1-yl)propan-2-yl]azetidine |
| SMILES | CC(C)(C)C1CN(C(C)(C)C2CN(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C17H34N2/c1-15(2,3)13-9-19(10-13)17(7,8)14-11-18(12-14)16(4,5)6/h13-14H,9-12H2,1-8H3 |
| InChIKey | HOMFIFBZBVSJGV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |