C22H19ClN2 — CID 17001968
2-(3-chlorophenyl)-1-[(2,5-dimethylphenyl)methyl]benzimidazole (PubChem CID 17001968) has the molecular formula C22H19ClN2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[(2,5-dimethylphenyl)methyl]benzimidazole.
| Compound Name | 2-(3-chlorophenyl)-1-[(2,5-dimethylphenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 17001968 |
| Molecular Formula | C22H19ClN2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[(2,5-dimethylphenyl)methyl]benzimidazole |
| SMILES | Cc1ccc(C)c(Cn2c(-c3cccc(Cl)c3)nc3ccccc32)c1 |
| InChI | InChI=1S/C22H19ClN2/c1-15-10-11-16(2)18(12-15)14-25-21-9-4-3-8-20(21)24-22(25)17-6-5-7-19(23)13-17/h3-13H,14H2,1-2H3 |
| InChIKey | OJJRQLSJMPIKGH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |